azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid

C10H22N2O5 — CID 87383497

IUPACazane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid
SMILESCCN(CC)CCOC(=O)CC(O)C(=O)O.N
InChIInChI=1S/C10H19NO5.H3N/c1-3-11(4-2)5-6-16-9(13)7-8(12)10(14)15;/h8,12H,3-7H2,1-2H3,(H,14,15);1H3
InChIKeyCODRDGPSCGNCPN-UHFFFAOYSA-N
MW250.29 g/mol
LogP-0.13
Rot. Bonds8

About azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid

azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid (PubChem CID 87383497) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid.

Molecular Properties

Compound Nameazane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid
PubChem CID87383497
Molecular FormulaC10H22N2O5
Molecular Weight250.29 g/mol
Exact Mass250.15
IUPAC Nameazane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid
SMILESCCN(CC)CCOC(=O)CC(O)C(=O)O.N
InChIInChI=1S/C10H19NO5.H3N/c1-3-11(4-2)5-6-16-9(13)7-8(12)10(14)15;/h8,12H,3-7H2,1-2H3,(H,14,15);1H3
InChIKeyCODRDGPSCGNCPN-UHFFFAOYSA-N
XLogP-0.13
TPSA122.07 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 5-0.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid?
The IUPAC name of azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid (CID 87383497) is azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid.
What is the SMILES notation for azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid?
The canonical SMILES for azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid is CCN(CC)CCOC(=O)CC(O)C(=O)O.N.
What is the InChIKey of azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid?
The InChIKey is CODRDGPSCGNCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5.H3N/c1-3-11(4-2)5-6-16-9(13)7-8(12)10(14)15;/h8,12H,3-7H2,1-2H3,(H,14,15);1H3.
What are the key properties of azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid?
azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid has a molecular weight of 250.29 g/mol, XLogP of -0.13, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid is sourced from PubChem (CID 87383497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).