C10H22N2O5 — CID 87383497
azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid (PubChem CID 87383497) has the molecular formula C10H22N2O5 and a molecular weight of 250.29 g/mol. Its IUPAC name is azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid.
| Compound Name | azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87383497 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | azane;4-[2-(diethylamino)ethoxy]-2-hydroxy-4-oxobutanoic acid |
| SMILES | CCN(CC)CCOC(=O)CC(O)C(=O)O.N |
| InChI | InChI=1S/C10H19NO5.H3N/c1-3-11(4-2)5-6-16-9(13)7-8(12)10(14)15;/h8,12H,3-7H2,1-2H3,(H,14,15);1H3 |
| InChIKey | CODRDGPSCGNCPN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |