C16H31NO8 — CID 162304466
2-(diethylamino)ethyl hexanoate;2,3-dihydroxybutanedioic acid (PubChem CID 162304466) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl hexanoate;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-(diethylamino)ethyl hexanoate;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 162304466 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-(diethylamino)ethyl hexanoate;2,3-dihydroxybutanedioic acid |
| SMILES | CCCCCC(=O)OCCN(CC)CC.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H25NO2.C4H6O6/c1-4-7-8-9-12(14)15-11-10-13(5-2)6-3;5-1(3(7)8)2(6)4(9)10/h4-11H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | WPTGSQLHNAPRJY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|