C14H27NO8 — CID 175053259
2-(diethylamino)ethyl butanoate;2,3-dihydroxybutanedioic acid (PubChem CID 175053259) has the molecular formula C14H27NO8 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-(diethylamino)ethyl butanoate;2,3-dihydroxybutanedioic acid.
| Compound Name | 2-(diethylamino)ethyl butanoate;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 175053259 |
| Molecular Formula | C14H27NO8 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-(diethylamino)ethyl butanoate;2,3-dihydroxybutanedioic acid |
| SMILES | CCCC(=O)OCCN(CC)CC.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H21NO2.C4H6O6/c1-4-7-10(12)13-9-8-11(5-2)6-3;5-1(3(7)8)2(6)4(9)10/h4-9H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | GBFKRBCRWZBIHV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |