About 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate
2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate (PubChem CID 137491943) has the molecular formula C18H33NO6S3
and a molecular weight of 455.66 g/mol. Its IUPAC name is 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate.
Molecular Properties
| Compound Name | 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate |
| PubChem CID | 137491943 |
| Molecular Formula | C18H33NO6S3 |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate |
| SMILES | CC(S)CC(=O)OCCN(CCOC(=O)CC(C)S)CCOC(=O)CC(C)S |
| InChI | InChI=1S/C18H33NO6S3/c1-13(26)10-16(20)23-7-4-19(5-8-24-17(21)11-14(2)27)6-9-25-18(22)12-15(3)28/h13-15,26-28H,4-12H2,1-3H3 |
| InChIKey | WDOFFFUSVISWDR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate?
The IUPAC name of 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate (CID 137491943) is 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate.
What is the SMILES notation for 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate?
The canonical SMILES for 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate is CC(S)CC(=O)OCCN(CCOC(=O)CC(C)S)CCOC(=O)CC(C)S.
What is the InChIKey of 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate?
The InChIKey is WDOFFFUSVISWDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO6S3/c1-13(26)10-16(20)23-7-4-19(5-8-24-17(21)11-14(2)27)6-9-25-18(22)12-15(3)28/h13-15,26-28H,4-12H2,1-3H3.
What are the key properties of 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate?
2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate has a molecular weight of 455.66 g/mol, XLogP of 2.04, 15 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-(3-sulfanylbutanoyloxy)ethyl]amino]ethyl 3-sulfanylbutanoate is sourced from PubChem (CID 137491943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).