C22H35N3O8S3 — CID 143515992
2-[2-methylidene-4,6-dioxo-3,5-bis[2-(3-sulfanylbutanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-sulfanylbutanoate (PubChem CID 143515992) has the molecular formula C22H35N3O8S3 and a molecular weight of 565.74 g/mol. Its IUPAC name is 2-[2-methylidene-4,6-dioxo-3,5-bis[2-(3-sulfanylbutanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-sulfanylbutanoate.
| Compound Name | 2-[2-methylidene-4,6-dioxo-3,5-bis[2-(3-sulfanylbutanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-sulfanylbutanoate |
|---|---|
| PubChem CID | 143515992 |
| Molecular Formula | C22H35N3O8S3 |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 2-[2-methylidene-4,6-dioxo-3,5-bis[2-(3-sulfanylbutanoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl 3-sulfanylbutanoate |
| SMILES | C=C1N(CCOC(=O)CC(C)S)C(=O)N(CCOC(=O)CC(C)S)C(=O)N1CCOC(=O)CC(C)S |
| InChI | InChI=1S/C22H35N3O8S3/c1-14(34)11-18(26)31-8-5-23-17(4)24(6-9-32-19(27)12-15(2)35)22(30)25(21(23)29)7-10-33-20(28)13-16(3)36/h14-16,34-36H,4-13H2,1-3H3 |
| InChIKey | RPBHNHNMEAPDOQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|