C19H34O6S3 — CID 177386696
3,3-bis(3-sulfanylbutanoyloxymethyl)pentyl 3-sulfanylbutanoate (PubChem CID 177386696) has the molecular formula C19H34O6S3 and a molecular weight of 454.68 g/mol. Its IUPAC name is 3,3-bis(3-sulfanylbutanoyloxymethyl)pentyl 3-sulfanylbutanoate.
| Compound Name | 3,3-bis(3-sulfanylbutanoyloxymethyl)pentyl 3-sulfanylbutanoate |
|---|---|
| PubChem CID | 177386696 |
| Molecular Formula | C19H34O6S3 |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3,3-bis(3-sulfanylbutanoyloxymethyl)pentyl 3-sulfanylbutanoate |
| SMILES | CCC(CCOC(=O)CC(C)S)(COC(=O)CC(C)S)COC(=O)CC(C)S |
| InChI | InChI=1S/C19H34O6S3/c1-5-19(11-24-17(21)9-14(3)27,12-25-18(22)10-15(4)28)6-7-23-16(20)8-13(2)26/h13-15,26-28H,5-12H2,1-4H3 |
| InChIKey | RGOIYFVKQCLDEG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|