C7H12O4S2 — CID 172730193
2-(3-sulfanylbutanoyloxy)ethylsulfanylformic acid (PubChem CID 172730193) has the molecular formula C7H12O4S2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(3-sulfanylbutanoyloxy)ethylsulfanylformic acid.
| Compound Name | 2-(3-sulfanylbutanoyloxy)ethylsulfanylformic acid |
|---|---|
| PubChem CID | 172730193 |
| Molecular Formula | C7H12O4S2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-(3-sulfanylbutanoyloxy)ethylsulfanylformic acid |
| SMILES | CC(S)CC(=O)OCCSC(=O)O |
| InChI | InChI=1S/C7H12O4S2/c1-5(12)4-6(8)11-2-3-13-7(9)10/h5,12H,2-4H2,1H3,(H,9,10) |
| InChIKey | HROGMLRXIBMCEK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|