C12H26O6S4 — CID 135306906
2-(2-hydroxyethyldisulfanyl)ethanol;bis(3-sulfanylbutanoic acid) (PubChem CID 135306906) has the molecular formula C12H26O6S4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-(2-hydroxyethyldisulfanyl)ethanol;bis(3-sulfanylbutanoic acid).
| Compound Name | 2-(2-hydroxyethyldisulfanyl)ethanol;bis(3-sulfanylbutanoic acid) |
|---|---|
| PubChem CID | 135306906 |
| Molecular Formula | C12H26O6S4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-(2-hydroxyethyldisulfanyl)ethanol;bis(3-sulfanylbutanoic acid) |
| SMILES | CC(S)CC(=O)O.CC(S)CC(=O)O.OCCSSCCO |
| InChI | InChI=1S/C4H10O2S2.2C4H8O2S/c5-1-3-7-8-4-2-6;2*1-3(7)2-4(5)6/h5-6H,1-4H2;2*3,7H,2H2,1H3,(H,5,6) |
| InChIKey | DZJCKRLYJYZGQR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|