C14H28O6S2 — CID 87478932
cyclohexane-1,1-diol;bis(3-sulfanylbutanoic acid) (PubChem CID 87478932) has the molecular formula C14H28O6S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is cyclohexane-1,1-diol;bis(3-sulfanylbutanoic acid).
| Compound Name | cyclohexane-1,1-diol;bis(3-sulfanylbutanoic acid) |
|---|---|
| PubChem CID | 87478932 |
| Molecular Formula | C14H28O6S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | cyclohexane-1,1-diol;bis(3-sulfanylbutanoic acid) |
| SMILES | CC(S)CC(=O)O.CC(S)CC(=O)O.OC1(O)CCCCC1 |
| InChI | InChI=1S/C6H12O2.2C4H8O2S/c7-6(8)4-2-1-3-5-6;2*1-3(7)2-4(5)6/h7-8H,1-5H2;2*3,7H,2H2,1H3,(H,5,6) |
| InChIKey | RFSBKKWZZRDREP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|