About cyclopentadecane-1,1-diol
cyclopentadecane-1,1-diol (PubChem CID 90867480) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is cyclopentadecane-1,1-diol.
Molecular Properties
| Compound Name | cyclopentadecane-1,1-diol |
| PubChem CID | 90867480 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | cyclopentadecane-1,1-diol |
| SMILES | OC1(O)CCCCCCCCCCCCCC1 |
| InChI | InChI=1S/C15H30O2/c16-15(17)13-11-9-7-5-3-1-2-4-6-8-10-12-14-15/h16-17H,1-14H2 |
| InChIKey | RMFFNBIXGZOVHW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopentadecane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentadecane-1,1-diol?
The IUPAC name of cyclopentadecane-1,1-diol (CID 90867480) is cyclopentadecane-1,1-diol.
What is the SMILES notation for cyclopentadecane-1,1-diol?
The canonical SMILES for cyclopentadecane-1,1-diol is OC1(O)CCCCCCCCCCCCCC1.
What is the InChIKey of cyclopentadecane-1,1-diol?
The InChIKey is RMFFNBIXGZOVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c16-15(17)13-11-9-7-5-3-1-2-4-6-8-10-12-14-15/h16-17H,1-14H2.
What are the key properties of cyclopentadecane-1,1-diol?
cyclopentadecane-1,1-diol has a molecular weight of 242.40 g/mol, XLogP of 4.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentadecane-1,1-diol is sourced from PubChem (CID 90867480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).