C12H26O4 — CID 19371840
cyclohexane-1,1-diol;hexane-1,6-diol (PubChem CID 19371840) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is cyclohexane-1,1-diol;hexane-1,6-diol.
| Compound Name | cyclohexane-1,1-diol;hexane-1,6-diol |
|---|---|
| PubChem CID | 19371840 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | cyclohexane-1,1-diol;hexane-1,6-diol |
| SMILES | OC1(O)CCCCC1.OCCCCCCO |
| InChI | InChI=1S/C6H12O2.C6H14O2/c7-6(8)4-2-1-3-5-6;7-5-3-1-2-4-6-8/h7-8H,1-5H2;7-8H,1-6H2 |
| InChIKey | QKXCLZVPRUYWTP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|