About cyclohexane-1,1-diol;methanol
cyclohexane-1,1-diol;methanol (PubChem CID 159463727) has the molecular formula C8H20O4
and a molecular weight of 180.24 g/mol. Its IUPAC name is cyclohexane-1,1-diol;methanol.
Molecular Properties
| Compound Name | cyclohexane-1,1-diol;methanol |
| PubChem CID | 159463727 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | cyclohexane-1,1-diol;methanol |
| SMILES | CO.CO.OC1(O)CCCCC1 |
| InChI | InChI=1S/C6H12O2.2CH4O/c7-6(8)4-2-1-3-5-6;2*1-2/h7-8H,1-5H2;2*2H,1H3 |
| InChIKey | LUXKHWIGUMJVIU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,1-diol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,1-diol;methanol?
The IUPAC name of cyclohexane-1,1-diol;methanol (CID 159463727) is cyclohexane-1,1-diol;methanol.
What is the SMILES notation for cyclohexane-1,1-diol;methanol?
The canonical SMILES for cyclohexane-1,1-diol;methanol is CO.CO.OC1(O)CCCCC1.
What is the InChIKey of cyclohexane-1,1-diol;methanol?
The InChIKey is LUXKHWIGUMJVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.2CH4O/c7-6(8)4-2-1-3-5-6;2*1-2/h7-8H,1-5H2;2*2H,1H3.
What are the key properties of cyclohexane-1,1-diol;methanol?
cyclohexane-1,1-diol;methanol has a molecular weight of 180.24 g/mol, XLogP of -0.15, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,1-diol;methanol is sourced from PubChem (CID 159463727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).