About azanide;cyclobutane-1,1-diol;platinum(2+)
azanide;cyclobutane-1,1-diol;platinum(2+) (PubChem CID 170659555) has the molecular formula C4H12N2O2Pt
and a molecular weight of 315.23 g/mol. Its IUPAC name is azanide;cyclobutane-1,1-diol;platinum(2+).
Molecular Properties
| Compound Name | azanide;cyclobutane-1,1-diol;platinum(2+) |
| PubChem CID | 170659555 |
| Molecular Formula | C4H12N2O2Pt |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | azanide;cyclobutane-1,1-diol;platinum(2+) |
| SMILES | OC1(O)CCC1.[NH2-].[NH2-].[Pt+2] |
| InChI | InChI=1S/C4H8O2.2H2N.Pt/c5-4(6)2-1-3-4;;;/h5-6H,1-3H2;2*1H2;/q;2*-1;+2 |
| InChIKey | ARAKCGJQEKSIQG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze azanide;cyclobutane-1,1-diol;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;cyclobutane-1,1-diol;platinum(2+)?
The IUPAC name of azanide;cyclobutane-1,1-diol;platinum(2+) (CID 170659555) is azanide;cyclobutane-1,1-diol;platinum(2+).
What is the SMILES notation for azanide;cyclobutane-1,1-diol;platinum(2+)?
The canonical SMILES for azanide;cyclobutane-1,1-diol;platinum(2+) is OC1(O)CCC1.[NH2-].[NH2-].[Pt+2].
What is the InChIKey of azanide;cyclobutane-1,1-diol;platinum(2+)?
The InChIKey is ARAKCGJQEKSIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.2H2N.Pt/c5-4(6)2-1-3-4;;;/h5-6H,1-3H2;2*1H2;/q;2*-1;+2.
What are the key properties of azanide;cyclobutane-1,1-diol;platinum(2+)?
azanide;cyclobutane-1,1-diol;platinum(2+) has a molecular weight of 315.23 g/mol, XLogP of 1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;cyclobutane-1,1-diol;platinum(2+) is sourced from PubChem (CID 170659555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).