About 1-aminocyclobutan-1-ol;hydrochloride
1-aminocyclobutan-1-ol;hydrochloride (PubChem CID 135146045) has the molecular formula C4H10ClNO
and a molecular weight of 123.58 g/mol. Its IUPAC name is 1-aminocyclobutan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-aminocyclobutan-1-ol;hydrochloride |
| PubChem CID | 135146045 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 1-aminocyclobutan-1-ol;hydrochloride |
| SMILES | Cl.NC1(O)CCC1 |
| InChI | InChI=1S/C4H9NO.ClH/c5-4(6)2-1-3-4;/h6H,1-3,5H2;1H |
| InChIKey | JMOFGJOBBFJZAF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminocyclobutan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminocyclobutan-1-ol;hydrochloride?
The IUPAC name of 1-aminocyclobutan-1-ol;hydrochloride (CID 135146045) is 1-aminocyclobutan-1-ol;hydrochloride.
What is the SMILES notation for 1-aminocyclobutan-1-ol;hydrochloride?
The canonical SMILES for 1-aminocyclobutan-1-ol;hydrochloride is Cl.NC1(O)CCC1.
What is the InChIKey of 1-aminocyclobutan-1-ol;hydrochloride?
The InChIKey is JMOFGJOBBFJZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.ClH/c5-4(6)2-1-3-4;/h6H,1-3,5H2;1H.
What are the key properties of 1-aminocyclobutan-1-ol;hydrochloride?
1-aminocyclobutan-1-ol;hydrochloride has a molecular weight of 123.58 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminocyclobutan-1-ol;hydrochloride is sourced from PubChem (CID 135146045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).