C3H9ClN2 — CID 141361875
cyclopropane-1,1-diamine;hydrochloride (PubChem CID 141361875) has the molecular formula C3H9ClN2 and a molecular weight of 108.57 g/mol. Its IUPAC name is cyclopropane-1,1-diamine;hydrochloride.
| Compound Name | cyclopropane-1,1-diamine;hydrochloride |
|---|---|
| PubChem CID | 141361875 |
| Molecular Formula | C3H9ClN2 |
| Molecular Weight | 108.57 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | cyclopropane-1,1-diamine;hydrochloride |
| SMILES | Cl.NC1(N)CC1 |
| InChI | InChI=1S/C3H8N2.ClH/c4-3(5)1-2-3;/h1-2,4-5H2;1H |
| InChIKey | RYTVWVFPNHTYCA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.57 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|