C6H14N2Pt+2 — CID 22338759
cyclohexane-1,1-diamine;platinum(2+) (PubChem CID 22338759) has the molecular formula C6H14N2Pt+2 and a molecular weight of 309.27 g/mol. Its IUPAC name is cyclohexane-1,1-diamine;platinum(2+).
| Compound Name | cyclohexane-1,1-diamine;platinum(2+) |
|---|---|
| PubChem CID | 22338759 |
| Molecular Formula | C6H14N2Pt+2 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | cyclohexane-1,1-diamine;platinum(2+) |
| SMILES | NC1(N)CCCCC1.[Pt+2] |
| InChI | InChI=1S/C6H14N2.Pt/c7-6(8)4-2-1-3-5-6;/h1-5,7-8H2;/q;+2 |
| InChIKey | UGQDIOUBRRLHMW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|