About bis(cyclodecane);cyclodecane-1,1-diamine
bis(cyclodecane);cyclodecane-1,1-diamine (PubChem CID 22325955) has the molecular formula C30H62N2
and a molecular weight of 450.84 g/mol. Its IUPAC name is bis(cyclodecane);cyclodecane-1,1-diamine.
Molecular Properties
| Compound Name | bis(cyclodecane);cyclodecane-1,1-diamine |
| PubChem CID | 22325955 |
| Molecular Formula | C30H62N2 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.49 |
| IUPAC Name | bis(cyclodecane);cyclodecane-1,1-diamine |
| SMILES | C1CCCCCCCCC1.C1CCCCCCCCC1.NC1(N)CCCCCCCCC1 |
| InChI | InChI=1S/C10H22N2.2C10H20/c11-10(12)8-6-4-2-1-3-5-7-9-10;2*1-2-4-6-8-10-9-7-5-3-1/h1-9,11-12H2;2*1-10H2 |
| InChIKey | FNJZJPFATKQHSL-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclodecane);cyclodecane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclodecane);cyclodecane-1,1-diamine?
The IUPAC name of bis(cyclodecane);cyclodecane-1,1-diamine (CID 22325955) is bis(cyclodecane);cyclodecane-1,1-diamine.
What is the SMILES notation for bis(cyclodecane);cyclodecane-1,1-diamine?
The canonical SMILES for bis(cyclodecane);cyclodecane-1,1-diamine is C1CCCCCCCCC1.C1CCCCCCCCC1.NC1(N)CCCCCCCCC1.
What is the InChIKey of bis(cyclodecane);cyclodecane-1,1-diamine?
The InChIKey is FNJZJPFATKQHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.2C10H20/c11-10(12)8-6-4-2-1-3-5-7-9-10;2*1-2-4-6-8-10-9-7-5-3-1/h1-9,11-12H2;2*1-10H2.
What are the key properties of bis(cyclodecane);cyclodecane-1,1-diamine?
bis(cyclodecane);cyclodecane-1,1-diamine has a molecular weight of 450.84 g/mol, XLogP of 9.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclodecane);cyclodecane-1,1-diamine is sourced from PubChem (CID 22325955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).