About carbanide;1-methylcyclohexan-1-amine;vanadium
carbanide;1-methylcyclohexan-1-amine;vanadium (PubChem CID 159436191) has the molecular formula C8H18NV-
and a molecular weight of 179.18 g/mol. Its IUPAC name is carbanide;1-methylcyclohexan-1-amine;vanadium.
Molecular Properties
| Compound Name | carbanide;1-methylcyclohexan-1-amine;vanadium |
| PubChem CID | 159436191 |
| Molecular Formula | C8H18NV- |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | carbanide;1-methylcyclohexan-1-amine;vanadium |
| SMILES | CC1(N)CCCCC1.[CH3-].[V] |
| InChI | InChI=1S/C7H15N.CH3.V/c1-7(8)5-3-2-4-6-7;;/h2-6,8H2,1H3;1H3;/q;-1; |
| InChIKey | SVHQKEZXHPWNLW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-methylcyclohexan-1-amine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-methylcyclohexan-1-amine;vanadium?
The IUPAC name of carbanide;1-methylcyclohexan-1-amine;vanadium (CID 159436191) is carbanide;1-methylcyclohexan-1-amine;vanadium.
What is the SMILES notation for carbanide;1-methylcyclohexan-1-amine;vanadium?
The canonical SMILES for carbanide;1-methylcyclohexan-1-amine;vanadium is CC1(N)CCCCC1.[CH3-].[V].
What is the InChIKey of carbanide;1-methylcyclohexan-1-amine;vanadium?
The InChIKey is SVHQKEZXHPWNLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CH3.V/c1-7(8)5-3-2-4-6-7;;/h2-6,8H2,1H3;1H3;/q;-1;.
What are the key properties of carbanide;1-methylcyclohexan-1-amine;vanadium?
carbanide;1-methylcyclohexan-1-amine;vanadium has a molecular weight of 179.18 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-methylcyclohexan-1-amine;vanadium is sourced from PubChem (CID 159436191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).