C12H27N3 — CID 163899329
1,3,5-trimethylcyclononane-1,3,5-triamine (PubChem CID 163899329) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1,3,5-trimethylcyclononane-1,3,5-triamine.
| Compound Name | 1,3,5-trimethylcyclononane-1,3,5-triamine |
|---|---|
| PubChem CID | 163899329 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1,3,5-trimethylcyclononane-1,3,5-triamine |
| SMILES | CC1(N)CCCCC(C)(N)CC(C)(N)C1 |
| InChI | InChI=1S/C12H27N3/c1-10(13)6-4-5-7-11(2,14)9-12(3,15)8-10/h4-9,13-15H2,1-3H3 |
| InChIKey | QIKWRGLXVYUECH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |