C12H24N2 — CID 144998428
3,10-dimethyl-3-azaspiro[5.5]undecan-10-amine (PubChem CID 144998428) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 3,10-dimethyl-3-azaspiro[5.5]undecan-10-amine.
| Compound Name | 3,10-dimethyl-3-azaspiro[5.5]undecan-10-amine |
|---|---|
| PubChem CID | 144998428 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3,10-dimethyl-3-azaspiro[5.5]undecan-10-amine |
| SMILES | CN1CCC2(CCCC(C)(N)C2)CC1 |
| InChI | InChI=1S/C12H24N2/c1-11(13)4-3-5-12(10-11)6-8-14(2)9-7-12/h3-10,13H2,1-2H3 |
| InChIKey | YAHPNEBFQSDTCL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |