C21H44N4 — CID 158463391
methane;bis(3-methyl-3,9-diazaspiro[5.5]undecane) (PubChem CID 158463391) has the molecular formula C21H44N4 and a molecular weight of 352.61 g/mol. Its IUPAC name is methane;bis(3-methyl-3,9-diazaspiro[5.5]undecane).
| Compound Name | methane;bis(3-methyl-3,9-diazaspiro[5.5]undecane) |
|---|---|
| PubChem CID | 158463391 |
| Molecular Formula | C21H44N4 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.36 |
| IUPAC Name | methane;bis(3-methyl-3,9-diazaspiro[5.5]undecane) |
| SMILES | C.CN1CCC2(CCNCC2)CC1.CN1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/2C10H20N2.CH4/c2*1-12-8-4-10(5-9-12)2-6-11-7-3-10;/h2*11H,2-9H2,1H3;1H4 |
| InChIKey | HFLMZYRWFYDFRW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |