C14H30N2 — CID 145168180
2,2-dimethylpropane;2-methyl-2,8-diazaspiro[4.5]decane (PubChem CID 145168180) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-methyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2,2-dimethylpropane;2-methyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 145168180 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2,2-dimethylpropane;2-methyl-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)C.CN1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C9H18N2.C5H12/c1-11-7-4-9(8-11)2-5-10-6-3-9;1-5(2,3)4/h10H,2-8H2,1H3;1-4H3 |
| InChIKey | WYKUFSUMUAISMZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |