C7H16Cl2N2 — CID 122360940
6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride (PubChem CID 122360940) has the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. Its IUPAC name is 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride.
| Compound Name | 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride |
|---|---|
| PubChem CID | 122360940 |
| Molecular Formula | C7H16Cl2N2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride |
| SMILES | CN1CCC2(CNC2)C1.Cl.Cl |
| InChI | InChI=1S/C7H14N2.2ClH/c1-9-3-2-7(6-9)4-8-5-7;;/h8H,2-6H2,1H3;2*1H |
| InChIKey | WEBNAXUEZUSVIY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |