About 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride
6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride (PubChem CID 122360940) has the molecular formula C7H16Cl2N2
and a molecular weight of 199.12 g/mol. Its IUPAC name is 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride.
Molecular Properties
| Compound Name | 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride |
| PubChem CID | 122360940 |
| Molecular Formula | C7H16Cl2N2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride |
| SMILES | CN1CCC2(CNC2)C1.Cl.Cl |
| InChI | InChI=1S/C7H14N2.2ClH/c1-9-3-2-7(6-9)4-8-5-7;;/h8H,2-6H2,1H3;2*1H |
| InChIKey | WEBNAXUEZUSVIY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride?
The IUPAC name of 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride (CID 122360940) is 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride.
What is the SMILES notation for 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride?
The canonical SMILES for 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride is CN1CCC2(CNC2)C1.Cl.Cl.
What is the InChIKey of 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride?
The InChIKey is WEBNAXUEZUSVIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2ClH/c1-9-3-2-7(6-9)4-8-5-7;;/h8H,2-6H2,1H3;2*1H.
What are the key properties of 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride?
6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride has a molecular weight of 199.12 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,6-diazaspiro[3.4]octane;dihydrochloride is sourced from PubChem (CID 122360940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).