About 7-methyl-2,7-diazaspiro[3.5]nonane;propane
7-methyl-2,7-diazaspiro[3.5]nonane;propane (PubChem CID 171103459) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 7-methyl-2,7-diazaspiro[3.5]nonane;propane.
Molecular Properties
| Compound Name | 7-methyl-2,7-diazaspiro[3.5]nonane;propane |
| PubChem CID | 171103459 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 7-methyl-2,7-diazaspiro[3.5]nonane;propane |
| SMILES | CCC.CN1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H16N2.C3H8/c1-10-4-2-8(3-5-10)6-9-7-8;1-3-2/h9H,2-7H2,1H3;3H2,1-2H3 |
| InChIKey | OTWZITXRGFQNTL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2,7-diazaspiro[3.5]nonane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,7-diazaspiro[3.5]nonane;propane?
The IUPAC name of 7-methyl-2,7-diazaspiro[3.5]nonane;propane (CID 171103459) is 7-methyl-2,7-diazaspiro[3.5]nonane;propane.
What is the SMILES notation for 7-methyl-2,7-diazaspiro[3.5]nonane;propane?
The canonical SMILES for 7-methyl-2,7-diazaspiro[3.5]nonane;propane is CCC.CN1CCC2(CC1)CNC2.
What is the InChIKey of 7-methyl-2,7-diazaspiro[3.5]nonane;propane?
The InChIKey is OTWZITXRGFQNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C3H8/c1-10-4-2-8(3-5-10)6-9-7-8;1-3-2/h9H,2-7H2,1H3;3H2,1-2H3.
What are the key properties of 7-methyl-2,7-diazaspiro[3.5]nonane;propane?
7-methyl-2,7-diazaspiro[3.5]nonane;propane has a molecular weight of 184.33 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,7-diazaspiro[3.5]nonane;propane is sourced from PubChem (CID 171103459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).