7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen

C8H18N2 — CID 162530655

IUPAC7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen
SMILESCN1CCC2(CC1)CNC2.[H][H]
InChIInChI=1S/C8H16N2.H2/c1-10-4-2-8(3-5-10)6-9-7-8;/h9H,2-7H2,1H3;1H
InChIKeySMSDVXZCRPNJQK-UHFFFAOYSA-N
MW142.25 g/mol
LogP0.55
Rot. Bonds

About 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen

7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen (PubChem CID 162530655) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen.

Molecular Properties

Compound Name7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen
PubChem CID162530655
Molecular FormulaC8H18N2
Molecular Weight142.25 g/mol
Exact Mass142.15
IUPAC Name7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen
SMILESCN1CCC2(CC1)CNC2.[H][H]
InChIInChI=1S/C8H16N2.H2/c1-10-4-2-8(3-5-10)6-9-7-8;/h9H,2-7H2,1H3;1H
InChIKeySMSDVXZCRPNJQK-UHFFFAOYSA-N
XLogP0.55
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.25
LogP ≤ 50.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen?
The IUPAC name of 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen (CID 162530655) is 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen.
What is the SMILES notation for 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen?
The canonical SMILES for 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen is CN1CCC2(CC1)CNC2.[H][H].
What is the InChIKey of 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen?
The InChIKey is SMSDVXZCRPNJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.H2/c1-10-4-2-8(3-5-10)6-9-7-8;/h9H,2-7H2,1H3;1H.
What are the key properties of 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen?
7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen has a molecular weight of 142.25 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,7-diazaspiro[3.5]nonane;molecular hydrogen is sourced from PubChem (CID 162530655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).