About ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane
ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane (PubChem CID 144923266) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 144923266 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CSN1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H16N2S.C2H6/c1-11-10-4-2-8(3-5-10)6-9-7-8;1-2/h9H,2-7H2,1H3;1-2H3 |
| InChIKey | XVVYSLGAOKHLAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane (CID 144923266) is ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane is CC.CSN1CCC2(CC1)CNC2.
What is the InChIKey of ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is XVVYSLGAOKHLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S.C2H6/c1-11-10-4-2-8(3-5-10)6-9-7-8;1-2/h9H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane?
ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 202.37 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 144923266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).