C10H22N2S — CID 144923266
ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane (PubChem CID 144923266) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 144923266 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | ethane;7-methylsulfanyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CSN1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C8H16N2S.C2H6/c1-11-10-4-2-8(3-5-10)6-9-7-8;1-2/h9H,2-7H2,1H3;1-2H3 |
| InChIKey | XVVYSLGAOKHLAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|