C11H22N2S — CID 138580292
2-tert-butyl-7-methylsulfanyl-2,7-diazaspiro[3.4]octane (PubChem CID 138580292) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is 2-tert-butyl-7-methylsulfanyl-2,7-diazaspiro[3.4]octane.
| Compound Name | 2-tert-butyl-7-methylsulfanyl-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 138580292 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-tert-butyl-7-methylsulfanyl-2,7-diazaspiro[3.4]octane |
| SMILES | CSN1CCC2(C1)CN(C(C)(C)C)C2 |
| InChI | InChI=1S/C11H22N2S/c1-10(2,3)12-7-11(8-12)5-6-13(9-11)14-4/h5-9H2,1-4H3 |
| InChIKey | CIFQDDNVSHKVQA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|