C10H19FN2 — CID 156707007
3-fluoro-9-methyl-3,9-diazaspiro[5.5]undecane (PubChem CID 156707007) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is 3-fluoro-9-methyl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-fluoro-9-methyl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 156707007 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 3-fluoro-9-methyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CN1CCC2(CC1)CCN(F)CC2 |
| InChI | InChI=1S/C10H19FN2/c1-12-6-2-10(3-7-12)4-8-13(11)9-5-10/h2-9H2,1H3 |
| InChIKey | JTJLDVDIEZNUHH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|