About 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride
1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride (PubChem CID 158415985) has the molecular formula C12H25ClN4
and a molecular weight of 260.81 g/mol. Its IUPAC name is 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride |
| PubChem CID | 158415985 |
| Molecular Formula | C12H25ClN4 |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride |
| SMILES | CC1(N)CCCC1.CC1(N=[N+]=[N-])CCCC1.Cl |
| InChI | InChI=1S/C6H11N3.C6H13N.ClH/c1-6(8-9-7)4-2-3-5-6;1-6(7)4-2-3-5-6;/h2-5H2,1H3;2-5,7H2,1H3;1H |
| InChIKey | SLLJVYKFEUHWFA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride?
The IUPAC name of 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride (CID 158415985) is 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride.
What is the SMILES notation for 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride?
The canonical SMILES for 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride is CC1(N)CCCC1.CC1(N=[N+]=[N-])CCCC1.Cl.
What is the InChIKey of 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride?
The InChIKey is SLLJVYKFEUHWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3.C6H13N.ClH/c1-6(8-9-7)4-2-3-5-6;1-6(7)4-2-3-5-6;/h2-5H2,1H3;2-5,7H2,1H3;1H.
What are the key properties of 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride?
1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride has a molecular weight of 260.81 g/mol, XLogP of 4.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-1-methylcyclopentane;1-methylcyclopentan-1-amine;hydrochloride is sourced from PubChem (CID 158415985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).