C8H15N3 — CID 130763722
trans-(1R,3S)-1-azido-1,3-dimethylcyclohexane (PubChem CID 130763722) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is trans-(1R,3S)-1-azido-1,3-dimethylcyclohexane.
| Compound Name | trans-(1R,3S)-1-azido-1,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 130763722 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | trans-(1R,3S)-1-azido-1,3-dimethylcyclohexane |
| SMILES | C[C@H]1CCC[C@@](C)(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C8H15N3/c1-7-4-3-5-8(2,6-7)10-11-9/h7H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | WVBNJXOUFVLYAU-JGVFFNPUSA-N |
| XLogP | 3.27 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|