C9H19N — CID 124509461
[(1R,3R)-1,3-dimethylcyclohexyl]methanamine (PubChem CID 124509461) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is [(1R,3R)-1,3-dimethylcyclohexyl]methanamine.
| Compound Name | [(1R,3R)-1,3-dimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 124509461 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | [(1R,3R)-1,3-dimethylcyclohexyl]methanamine |
| SMILES | C[C@@H]1CCC[C@@](C)(CN)C1 |
| InChI | InChI=1S/C9H19N/c1-8-4-3-5-9(2,6-8)7-10/h8H,3-7,10H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | NZBHSANJTPXPPV-RKDXNWHRSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |