C12H26N2O — CID 170721292
N-[[(1R,3S)-3-(aminomethyl)-3-methylcyclohexyl]methyl]formamide;ethane (PubChem CID 170721292) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-[[(1R,3S)-3-(aminomethyl)-3-methylcyclohexyl]methyl]formamide;ethane.
| Compound Name | N-[[(1R,3S)-3-(aminomethyl)-3-methylcyclohexyl]methyl]formamide;ethane |
|---|---|
| PubChem CID | 170721292 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-[[(1R,3S)-3-(aminomethyl)-3-methylcyclohexyl]methyl]formamide;ethane |
| SMILES | CC.C[C@]1(CN)CCC[C@@H](CNC=O)C1 |
| InChI | InChI=1S/C10H20N2O.C2H6/c1-10(7-11)4-2-3-9(5-10)6-12-8-13;1-2/h8-9H,2-7,11H2,1H3,(H,12,13);1-2H3/t9-,10+;/m1./s1 |
| InChIKey | XOUIAJWAQVHSQL-UXQCFNEQSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|