C9H20N2O — CID 145231026
ethane;N-[(1-methylpyrrolidin-3-yl)methyl]formamide (PubChem CID 145231026) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is ethane;N-[(1-methylpyrrolidin-3-yl)methyl]formamide.
| Compound Name | ethane;N-[(1-methylpyrrolidin-3-yl)methyl]formamide |
|---|---|
| PubChem CID | 145231026 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;N-[(1-methylpyrrolidin-3-yl)methyl]formamide |
| SMILES | CC.CN1CCC(CNC=O)C1 |
| InChI | InChI=1S/C7H14N2O.C2H6/c1-9-3-2-7(5-9)4-8-6-10;1-2/h6-7H,2-5H2,1H3,(H,8,10);1-2H3 |
| InChIKey | NDPCCYGRUCUQDA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|