About formic acid;1-methylcyclobutan-1-amine;hydrochloride
formic acid;1-methylcyclobutan-1-amine;hydrochloride (PubChem CID 175593564) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is formic acid;1-methylcyclobutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | formic acid;1-methylcyclobutan-1-amine;hydrochloride |
| PubChem CID | 175593564 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | formic acid;1-methylcyclobutan-1-amine;hydrochloride |
| SMILES | CC1(N)CCC1.Cl.O=CO |
| InChI | InChI=1S/C5H11N.CH2O2.ClH/c1-5(6)3-2-4-5;2-1-3;/h2-4,6H2,1H3;1H,(H,2,3);1H |
| InChIKey | JIQMPEOMCPQRIL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-methylcyclobutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-methylcyclobutan-1-amine;hydrochloride?
The IUPAC name of formic acid;1-methylcyclobutan-1-amine;hydrochloride (CID 175593564) is formic acid;1-methylcyclobutan-1-amine;hydrochloride.
What is the SMILES notation for formic acid;1-methylcyclobutan-1-amine;hydrochloride?
The canonical SMILES for formic acid;1-methylcyclobutan-1-amine;hydrochloride is CC1(N)CCC1.Cl.O=CO.
What is the InChIKey of formic acid;1-methylcyclobutan-1-amine;hydrochloride?
The InChIKey is JIQMPEOMCPQRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.CH2O2.ClH/c1-5(6)3-2-4-5;2-1-3;/h2-4,6H2,1H3;1H,(H,2,3);1H.
What are the key properties of formic acid;1-methylcyclobutan-1-amine;hydrochloride?
formic acid;1-methylcyclobutan-1-amine;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of 1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-methylcyclobutan-1-amine;hydrochloride is sourced from PubChem (CID 175593564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).