About formic acid;1-methylcyclohexan-1-ol
formic acid;1-methylcyclohexan-1-ol (PubChem CID 163667859) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is formic acid;1-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | formic acid;1-methylcyclohexan-1-ol |
| PubChem CID | 163667859 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | formic acid;1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCCCC1.O=CO |
| InChI | InChI=1S/C7H14O.CH2O2/c1-7(8)5-3-2-4-6-7;2-1-3/h8H,2-6H2,1H3;1H,(H,2,3) |
| InChIKey | IZZYTMSIVMVKRN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-methylcyclohexan-1-ol?
The IUPAC name of formic acid;1-methylcyclohexan-1-ol (CID 163667859) is formic acid;1-methylcyclohexan-1-ol.
What is the SMILES notation for formic acid;1-methylcyclohexan-1-ol?
The canonical SMILES for formic acid;1-methylcyclohexan-1-ol is CC1(O)CCCCC1.O=CO.
What is the InChIKey of formic acid;1-methylcyclohexan-1-ol?
The InChIKey is IZZYTMSIVMVKRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.CH2O2/c1-7(8)5-3-2-4-6-7;2-1-3/h8H,2-6H2,1H3;1H,(H,2,3).
What are the key properties of formic acid;1-methylcyclohexan-1-ol?
formic acid;1-methylcyclohexan-1-ol has a molecular weight of 160.21 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-methylcyclohexan-1-ol is sourced from PubChem (CID 163667859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).