About cerium;1-methylcyclohexan-1-ol
cerium;1-methylcyclohexan-1-ol (PubChem CID 146687678) has the molecular formula C7H14CeO
and a molecular weight of 254.30 g/mol. Its IUPAC name is cerium;1-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | cerium;1-methylcyclohexan-1-ol |
| PubChem CID | 146687678 |
| Molecular Formula | C7H14CeO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | cerium;1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCCCC1.[Ce] |
| InChI | InChI=1S/C7H14O.Ce/c1-7(8)5-3-2-4-6-7;/h8H,2-6H2,1H3; |
| InChIKey | IMNCIOKCVRVBGF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cerium;1-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;1-methylcyclohexan-1-ol?
The IUPAC name of cerium;1-methylcyclohexan-1-ol (CID 146687678) is cerium;1-methylcyclohexan-1-ol.
What is the SMILES notation for cerium;1-methylcyclohexan-1-ol?
The canonical SMILES for cerium;1-methylcyclohexan-1-ol is CC1(O)CCCCC1.[Ce].
What is the InChIKey of cerium;1-methylcyclohexan-1-ol?
The InChIKey is IMNCIOKCVRVBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.Ce/c1-7(8)5-3-2-4-6-7;/h8H,2-6H2,1H3;.
What are the key properties of cerium;1-methylcyclohexan-1-ol?
cerium;1-methylcyclohexan-1-ol has a molecular weight of 254.30 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;1-methylcyclohexan-1-ol is sourced from PubChem (CID 146687678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).