About lithium 1-methylcyclopentan-1-ol
lithium 1-methylcyclopentan-1-ol (PubChem CID 18764027) has the molecular formula C6H12LiO+
and a molecular weight of 107.10 g/mol. Its IUPAC name is lithium 1-methylcyclopentan-1-ol.
Molecular Properties
| Compound Name | lithium 1-methylcyclopentan-1-ol |
| PubChem CID | 18764027 |
| Molecular Formula | C6H12LiO+ |
| Molecular Weight | 107.10 g/mol |
| Exact Mass | 107.10 |
| IUPAC Name | lithium 1-methylcyclopentan-1-ol |
| SMILES | CC1(O)CCCC1.[Li+] |
| InChI | InChI=1S/C6H12O.Li/c1-6(7)4-2-3-5-6;/h7H,2-5H2,1H3;/q;+1 |
| InChIKey | NVRTVSVDJJWKIO-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.10 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium 1-methylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-methylcyclopentan-1-ol?
The IUPAC name of lithium 1-methylcyclopentan-1-ol (CID 18764027) is lithium 1-methylcyclopentan-1-ol.
What is the SMILES notation for lithium 1-methylcyclopentan-1-ol?
The canonical SMILES for lithium 1-methylcyclopentan-1-ol is CC1(O)CCCC1.[Li+].
What is the InChIKey of lithium 1-methylcyclopentan-1-ol?
The InChIKey is NVRTVSVDJJWKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.Li/c1-6(7)4-2-3-5-6;/h7H,2-5H2,1H3;/q;+1.
What are the key properties of lithium 1-methylcyclopentan-1-ol?
lithium 1-methylcyclopentan-1-ol has a molecular weight of 107.10 g/mol, XLogP of -1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-methylcyclopentan-1-ol is sourced from PubChem (CID 18764027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).