C13H24O — CID 102083415
(5R,10R)-4,4,10-trimethylspiro[4.5]decan-10-ol (PubChem CID 102083415) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (5R,10R)-4,4,10-trimethylspiro[4.5]decan-10-ol.
| Compound Name | (5R,10R)-4,4,10-trimethylspiro[4.5]decan-10-ol |
|---|---|
| PubChem CID | 102083415 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (5R,10R)-4,4,10-trimethylspiro[4.5]decan-10-ol |
| SMILES | CC1(C)CCC[C@]12CCCC[C@@]2(C)O |
| InChI | InChI=1S/C13H24O/c1-11(2)7-6-10-13(11)9-5-4-8-12(13,3)14/h14H,4-10H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | REIICYVOHMAIFC-CHWSQXEVSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |