C12H28N2O2 — CID 174848693
cyclohexane-1,1-diamine;2-methylpentane-2,4-diol (PubChem CID 174848693) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is cyclohexane-1,1-diamine;2-methylpentane-2,4-diol.
| Compound Name | cyclohexane-1,1-diamine;2-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 174848693 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | cyclohexane-1,1-diamine;2-methylpentane-2,4-diol |
| SMILES | CC(O)CC(C)(C)O.NC1(N)CCCCC1 |
| InChI | InChI=1S/C6H14N2.C6H14O2/c7-6(8)4-2-1-3-5-6;1-5(7)4-6(2,3)8/h1-5,7-8H2;5,7-8H,4H2,1-3H3 |
| InChIKey | OCQLIWKRJNAZKD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|