C12H22N2O2 — CID 174865255
benzene-1,2-diamine;2-methylpentane-2,4-diol (PubChem CID 174865255) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is benzene-1,2-diamine;2-methylpentane-2,4-diol.
| Compound Name | benzene-1,2-diamine;2-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 174865255 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | benzene-1,2-diamine;2-methylpentane-2,4-diol |
| SMILES | CC(O)CC(C)(C)O.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.C6H14O2/c7-5-3-1-2-4-6(5)8;1-5(7)4-6(2,3)8/h1-4H,7-8H2;5,7-8H,4H2,1-3H3 |
| InChIKey | YVOKOFSCRDKGJY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|