About 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol
1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol (PubChem CID 173407184) has the molecular formula C20H26O5
and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol.
Molecular Properties
| Compound Name | 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol |
| PubChem CID | 173407184 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol |
| SMILES | CC(O)CC(O)(OC(O)(CC(C)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26O5/c1-15(21)13-19(23,17-9-5-3-6-10-17)25-20(24,14-16(2)22)18-11-7-4-8-12-18/h3-12,15-16,21-24H,13-14H2,1-2H3 |
| InChIKey | DGQCEVRXSZMKHQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol?
The IUPAC name of 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol (CID 173407184) is 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol.
What is the SMILES notation for 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol?
The canonical SMILES for 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol is CC(O)CC(O)(OC(O)(CC(C)O)c1ccccc1)c1ccccc1.
What is the InChIKey of 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol?
The InChIKey is DGQCEVRXSZMKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O5/c1-15(21)13-19(23,17-9-5-3-6-10-17)25-20(24,14-16(2)22)18-11-7-4-8-12-18/h3-12,15-16,21-24H,13-14H2,1-2H3.
What are the key properties of 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol?
1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol has a molecular weight of 346.42 g/mol, XLogP of 2.24, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol is sourced from PubChem (CID 173407184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).