C20H26O5 — CID 173407184
1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol (PubChem CID 173407184) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol.
| Compound Name | 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 173407184 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(1,3-dihydroxy-1-phenylbutoxy)-1-phenylbutane-1,3-diol |
| SMILES | CC(O)CC(O)(OC(O)(CC(C)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26O5/c1-15(21)13-19(23,17-9-5-3-6-10-17)25-20(24,14-16(2)22)18-11-7-4-8-12-18/h3-12,15-16,21-24H,13-14H2,1-2H3 |
| InChIKey | DGQCEVRXSZMKHQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|