C17H20O2 — CID 135025733
2,2-diphenylpentane-1,4-diol (PubChem CID 135025733) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2,2-diphenylpentane-1,4-diol.
| Compound Name | 2,2-diphenylpentane-1,4-diol |
|---|---|
| PubChem CID | 135025733 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2,2-diphenylpentane-1,4-diol |
| SMILES | CC(O)CC(CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-14(19)12-17(13-18,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,18-19H,12-13H2,1H3 |
| InChIKey | QXCOYUUCSTZWFE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |