C26H31NO3 — CID 69304223
1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,3-diphenylbutane-1,4-diol (PubChem CID 69304223) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,3-diphenylbutane-1,4-diol.
| Compound Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,3-diphenylbutane-1,4-diol |
|---|---|
| PubChem CID | 69304223 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,3-diphenylbutane-1,4-diol |
| SMILES | CN(C)CCOc1ccc(C(O)CC(CO)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO3/c1-27(2)17-18-30-24-15-13-21(14-16-24)25(29)19-26(20-28,22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,25,28-29H,17-20H2,1-2H3 |
| InChIKey | OMDXIOOWKVIRAB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |