C26H29I2NO — CID 69003301
2-[4-(1,2-diiodo-1,2-diphenylbutyl)phenoxy]-N,N-dimethylethanamine (PubChem CID 69003301) has the molecular formula C26H29I2NO and a molecular weight of 625.33 g/mol. Its IUPAC name is 2-[4-(1,2-diiodo-1,2-diphenylbutyl)phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(1,2-diiodo-1,2-diphenylbutyl)phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 69003301 |
| Molecular Formula | C26H29I2NO |
| Molecular Weight | 625.33 g/mol |
| Exact Mass | 625.03 |
| IUPAC Name | 2-[4-(1,2-diiodo-1,2-diphenylbutyl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CCC(I)(c1ccccc1)C(I)(c1ccccc1)c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C26H29I2NO/c1-4-25(27,21-11-7-5-8-12-21)26(28,22-13-9-6-10-14-22)23-15-17-24(18-16-23)30-20-19-29(2)3/h5-18H,4,19-20H2,1-3H3 |
| InChIKey | JHTYCODQJVOKIT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.33 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|