C26H29NO2 — CID 123847593
1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-2-en-1-ol (PubChem CID 123847593) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-2-en-1-ol.
| Compound Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 123847593 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-3,4-diphenylbut-2-en-1-ol |
| SMILES | CN(C)CCOc1ccc(C(O)C=C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO2/c1-27(2)17-18-29-25-15-13-23(14-16-25)26(28)20-24(22-11-7-4-8-12-22)19-21-9-5-3-6-10-21/h3-16,20,26,28H,17-19H2,1-2H3 |
| InChIKey | WICXPVSNIBHTNX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |