C26H31NO2 — CID 123134411
3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbutyl]phenol (PubChem CID 123134411) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbutyl]phenol.
| Compound Name | 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbutyl]phenol |
|---|---|
| PubChem CID | 123134411 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbutyl]phenol |
| SMILES | CCC(c1ccccc1)C(c1ccc(OCCN(C)C)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C26H31NO2/c1-4-25(20-9-6-5-7-10-20)26(22-11-8-12-23(28)19-22)21-13-15-24(16-14-21)29-18-17-27(2)3/h5-16,19,25-26,28H,4,17-18H2,1-3H3 |
| InChIKey | QAYFBVRNOWKIHB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |