C26H29NO2 — CID 67671283
3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylbut-2-enyl]phenol (PubChem CID 67671283) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylbut-2-enyl]phenol.
| Compound Name | 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylbut-2-enyl]phenol |
|---|---|
| PubChem CID | 67671283 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-3-phenylbut-2-enyl]phenol |
| SMILES | CC(=CC(c1ccc(OCCN(C)C)cc1)c1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c1-20(21-8-5-4-6-9-21)18-26(23-10-7-11-24(28)19-23)22-12-14-25(15-13-22)29-17-16-27(2)3/h4-15,18-19,26,28H,16-17H2,1-3H3 |
| InChIKey | UEEXCJVTZFYYPV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |