C29H35NO4 — CID 101045475
1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-[4-(methoxymethoxy)phenyl]-2-phenylpent-4-en-2-ol (PubChem CID 101045475) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-[4-(methoxymethoxy)phenyl]-2-phenylpent-4-en-2-ol.
| Compound Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-[4-(methoxymethoxy)phenyl]-2-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 101045475 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 1-[4-[2-(dimethylamino)ethoxy]phenyl]-1-[4-(methoxymethoxy)phenyl]-2-phenylpent-4-en-2-ol |
| SMILES | C=CCC(O)(c1ccccc1)C(c1ccc(OCCN(C)C)cc1)c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C29H35NO4/c1-5-19-29(31,25-9-7-6-8-10-25)28(24-13-17-27(18-14-24)34-22-32-4)23-11-15-26(16-12-23)33-21-20-30(2)3/h5-18,28,31H,1,19-22H2,2-4H3 |
| InChIKey | BNKNHFGGNWGNCU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|