C12H19O5P — CID 67770210
3-phenylhex-5-ene-2,3-diol;phosphorous acid (PubChem CID 67770210) has the molecular formula C12H19O5P and a molecular weight of 274.25 g/mol. Its IUPAC name is 3-phenylhex-5-ene-2,3-diol;phosphorous acid.
| Compound Name | 3-phenylhex-5-ene-2,3-diol;phosphorous acid |
|---|---|
| PubChem CID | 67770210 |
| Molecular Formula | C12H19O5P |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-phenylhex-5-ene-2,3-diol;phosphorous acid |
| SMILES | C=CCC(O)(c1ccccc1)C(C)O.OP(O)O |
| InChI | InChI=1S/C12H16O2.H3O3P/c1-3-9-12(14,10(2)13)11-7-5-4-6-8-11;1-4(2)3/h3-8,10,13-14H,1,9H2,2H3;1-3H |
| InChIKey | JFZNKHUCKOMIEE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|