C10H10Li2O2 — CID 134892935
dilithium;1-phenylbut-3-ene-1,1-diolate (PubChem CID 134892935) has the molecular formula C10H10Li2O2 and a molecular weight of 176.07 g/mol. Its IUPAC name is dilithium;1-phenylbut-3-ene-1,1-diolate.
| Compound Name | dilithium;1-phenylbut-3-ene-1,1-diolate |
|---|---|
| PubChem CID | 134892935 |
| Molecular Formula | C10H10Li2O2 |
| Molecular Weight | 176.07 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | dilithium;1-phenylbut-3-ene-1,1-diolate |
| SMILES | C=CCC([O-])([O-])c1ccccc1.[Li+].[Li+] |
| InChI | InChI=1S/C10H10O2.2Li/c1-2-8-10(11,12)9-6-4-3-5-7-9;;/h2-7H,1,8H2;;/q-2;2*+1 |
| InChIKey | AHAJHKSSKGKVRE-UHFFFAOYSA-N |
| XLogP | -5.86 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.07 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|